cas: 847406-13-7 — see every product listed under this CAS number, including other names
Ethyl 1-(5-bromopyridin-3-yl)piperidine-4-carboxylate (CAS 847406-13-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GADV-50mg |
| cas | 847406-13-7 |
| size | 50mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 136.40 Pln | |
| Chemat | 250mg | 179.60 Pln |
| delivery time | 3 weeks |
|---|
Ethyl 1-(5-bromo-3-pyridinyl)piperidine-4-carboxylate (CAS 847406-13-7) is a chemical compound with the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. IUPAC name: ethyl 1-(5-bromo-3-pyridinyl)piperidine-4-carboxylate. InChIKey: CEZIJGBDNLFOLM-UHFFFAOYSA-N.
| Molecular formula | C13H17BrN2O2 |
|---|---|
| Molecular weight | 313.19 g/mol |
| IUPAC name | ethyl 1-(5-bromo-3-pyridinyl)piperidine-4-carboxylate |
| InChIKey | CEZIJGBDNLFOLM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CCN(CC1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)