cas: 172602-83-4 — see every product listed under this CAS number, including other names
Ethyl 1-cyclopropyl-8-ethoxy-6,7-difluoro-4-oxo-1,4-dihydroquinoline-3-carboxylate, 97% (CAS 172602-83-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A434657-100mg |
| cas | 172602-83-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1405.00 Pln | |
| Ambeed | 5g | 6377.88 Pln | |
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 553.16 Pln | |
| BLDpharm | 1g | 1508.38 Pln | |
| BLDpharm | 5g | 6873.16 Pln | |
| Fluorochem | 100mg | 742.46 Pln | |
| Fluorochem | 250mg | 1174.60 Pln | |
| Fluorochem | 1g | 3007.29 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 1-cyclopropyl-8-ethoxy-6,7-difluoro-4-oxoquinoline-3-carboxylate (CAS 172602-83-4) is a chemical compound with the molecular formula C17H17F2NO4 and a molecular weight of 337.32 g/mol. IUPAC name: ethyl 1-cyclopropyl-8-ethoxy-6,7-difluoro-4-oxoquinoline-3-carboxylate. InChIKey: HVSSSDATQQUFJP-UHFFFAOYSA-N.
| Molecular formula | C17H17F2NO4 |
|---|---|
| Molecular weight | 337.32 g/mol |
| IUPAC name | ethyl 1-cyclopropyl-8-ethoxy-6,7-difluoro-4-oxoquinoline-3-carboxylate |
| InChIKey | HVSSSDATQQUFJP-UHFFFAOYSA-N |
| SMILES | CCOC1=C2C(=CC(=C1F)F)C(=O)C(=CN2C3CC3)C(=O)OCC |
Computed by PubChem (NCBI)