Products 399-92-8

CAS 399-92-8 is the registry number for Ethyl 2,3,3,3-tetrafluoropropionate, 97%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 2,3,3,3-tetrafluoropropanoate (CAS 399-92-8) is a chemical compound with the molecular formula C5H6F4O2 and a molecular weight of 174.09 g/mol. IUPAC name: ethyl 2,3,3,3-tetrafluoropropanoate. InChIKey: YJROLMPBFOAPOX-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6F4O2
Molecular weight174.09 g/mol
IUPAC nameethyl 2,3,3,3-tetrafluoropropanoate
InChIKeyYJROLMPBFOAPOX-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(F)(F)F)F

Computed by PubChem (NCBI)