cas: 737772-45-1 — see every product listed under this CAS number, including other names
Ethyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate, 95%, 95% (CAS 737772-45-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AJW6-100mg |
| cas | 737772-45-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 2402.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate (CAS 737772-45-1) is a chemical compound with the molecular formula C13H11F3O4 and a molecular weight of 288.22 g/mol. IUPAC name: ethyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate. InChIKey: SMRXWQFVAQRZKU-UHFFFAOYSA-N.
| Molecular formula | C13H11F3O4 |
|---|---|
| Molecular weight | 288.22 g/mol |
| IUPAC name | ethyl 2,4-dioxo-4-[3-(trifluoromethyl)phenyl]butanoate |
| InChIKey | SMRXWQFVAQRZKU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)