cas: 1368277-98-8 — see every product listed under this CAS number, including other names
Ethyl 2,6-dimethyl-4-(propan-2-yloxy)benzoate (CAS 1368277-98-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F633124-1G |
| cas | 1368277-98-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3986.11 Pln | |
| Fluorochem | 5g | 11842.72 Pln |
| delivery time | 3-4 weeks |
|---|
Ethyl 2,6-dimethyl-4-propan-2-yloxybenzoate (CAS 1368277-98-8) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: ethyl 2,6-dimethyl-4-propan-2-yloxybenzoate. InChIKey: WOLZKWJGLMSLRZ-UHFFFAOYSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | ethyl 2,6-dimethyl-4-propan-2-yloxybenzoate |
| InChIKey | WOLZKWJGLMSLRZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1C)OC(C)C)C |
Computed by PubChem (NCBI)