cas: 69065-91-4 — see every product listed under this CAS number, including other names
Ethyl 2-((4-fluorophenyl)amino)-2-oxoacetate 98% (CAS 69065-91-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A219200-250mg |
| cas | 69065-91-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 303.62 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2545.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A219200 |
Ethyl 2-(4-fluoroanilino)-2-oxoacetate (CAS 69065-91-4) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: ethyl 2-(4-fluoroanilino)-2-oxoacetate. InChIKey: OUBZLXSQKQMFAH-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | ethyl 2-(4-fluoroanilino)-2-oxoacetate |
| InChIKey | OUBZLXSQKQMFAH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)NC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)