cas: 1202805-23-9 — see every product listed under this CAS number, including other names
Ethyl 2-((5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)amino)acetate 96% (CAS 1202805-23-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A429770-100mg |
| cas | 1202805-23-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A429770 |
Ethyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]acetate (CAS 1202805-23-9) is a chemical compound with the molecular formula C14H22BN3O4 and a molecular weight of 307.16 g/mol. IUPAC name: ethyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]acetate. InChIKey: HSOCAWHXCILLMG-UHFFFAOYSA-N.
| Molecular formula | C14H22BN3O4 |
|---|---|
| Molecular weight | 307.16 g/mol |
| IUPAC name | ethyl 2-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]acetate |
| InChIKey | HSOCAWHXCILLMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)NCC(=O)OCC |
Computed by PubChem (NCBI)