cas: 1159823-83-2 — see every product listed under this CAS number, including other names
Ethyl 2-((5-bromopyrimidin-2-yl)amino)acetate 97% (CAS 1159823-83-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A604207-250mg |
| cas | 1159823-83-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1310.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A604207 |
Ethyl 2-[(5-bromopyrimidin-2-yl)amino]acetate (CAS 1159823-83-2) is a chemical compound with the molecular formula C8H10BrN3O2 and a molecular weight of 260.09 g/mol. IUPAC name: ethyl 2-[(5-bromopyrimidin-2-yl)amino]acetate. InChIKey: MSJIEFRRPDPTHH-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3O2 |
|---|---|
| Molecular weight | 260.09 g/mol |
| IUPAC name | ethyl 2-[(5-bromopyrimidin-2-yl)amino]acetate |
| InChIKey | MSJIEFRRPDPTHH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=NC=C(C=N1)Br |
Computed by PubChem (NCBI)