cas: 1220968-24-0 — see every product listed under this CAS number, including other names
Ethyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)propanoate, 97% (CAS 1220968-24-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F454486-100MG |
| cas | 1220968-24-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 1075.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate (CAS 1220968-24-0) is a chemical compound with the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. IUPAC name: ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate. InChIKey: ZOJGQOTZUPOALJ-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4 |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | ethyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propanoate |
| InChIKey | ZOJGQOTZUPOALJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(C)C(=O)OCC |
Computed by PubChem (NCBI)