cas: 1864053-11-1 — see every product listed under this CAS number, including other names
Ethyl 2-(8H-Indeno[1,2-c]thiophen-8-yl)acetate, ≥95%, ≥95% (CAS 1864053-11-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2S4-250mg |
| cas | 1864053-11-1 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1130.00 Pln | |
| Chemat | 1g | 2781.20 Pln | |
| Chemat | 5g | 7317.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4H-indeno[2,3-c]thiophen-4-yl)acetate (CAS 1864053-11-1) is a chemical compound with the molecular formula C15H14O2S and a molecular weight of 258.3 g/mol. IUPAC name: ethyl 2-(4H-indeno[2,3-c]thiophen-4-yl)acetate. InChIKey: DRVWXWRUAQILHD-UHFFFAOYSA-N.
| Molecular formula | C15H14O2S |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | ethyl 2-(4H-indeno[2,3-c]thiophen-4-yl)acetate |
| InChIKey | DRVWXWRUAQILHD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1C2=CC=CC=C2C3=CSC=C13 |
Computed by PubChem (NCBI)