Ethyl 2-(diethoxyphosphoryl)propanoate, 98%
cas: 3699-66-9 — see every product listed under this CAS number, including other names
Ethyl 2-(diethoxyphosphoryl)propanoate, 98% (CAS 3699-66-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 50g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A104496-1g |
| cas | 3699-66-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 225.75 Pln | |
| Ambeed | 100g | 342.56 Pln | |
| Ambeed | 500g | 1393.88 Pln | |
| Ambeed | 1kg | 2317.25 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 50g | 155.60 Pln | |
| Chemat | 100g | 237.20 Pln | |
| Chemat | 250g | 482.00 Pln | |
| Chemat | 500g | 921.60 Pln | |
| Chemat | 5kg | 4896.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 358.79 Pln | |
| BLDpharm | 500g | 1497.28 Pln | |
| BLDpharm | 1kg | 2496.92 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Ethyl 2-diethoxyphosphorylpropanoate (CAS 3699-66-9) is a chemical compound with the molecular formula C9H19O5P and a molecular weight of 238.22 g/mol. IUPAC name: ethyl 2-diethoxyphosphorylpropanoate. InChIKey: BVSRWCMAJISCTD-UHFFFAOYSA-N.
| Molecular formula | C9H19O5P |
|---|---|
| Molecular weight | 238.22 g/mol |
| IUPAC name | ethyl 2-diethoxyphosphorylpropanoate |
| InChIKey | BVSRWCMAJISCTD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)P(=O)(OCC)OCC |
Computed by PubChem (NCBI)
Synonyms:
Triethyl 2-phosphonopropionate, Ethyl 2-(diethoxyphosphoryl)propanoate, ethyl 2-diethoxyphosphorylpropanoate, Ethyl-2-(diethylphosphono)propanoate, 2-(diethoxyphosphoryl)propionic acid ethyl ester, 2-Phosphonopropionic Acid Triethyl Ester, Ethyl 2~(diethoxyphosphoryl)propanoate, Diethyl 1-(carbethoxy)ethylphosphonate, Propanoic acid, 2-(diethoxyphosphinyl)-, ethyl ester, triethyl 2-phosphopropionate