cas: 67226-78-2 — see every product listed under this CAS number, including other names
Ethyl 2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]acetate, ≥98%, ≥98% (CAS 67226-78-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116Q4G-250mg |
| cas | 67226-78-2 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 1014.80 Pln | |
| Chemat | 5g | 3054.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-[tert-butyl(dimethyl)silyl]oxyacetate (CAS 67226-78-2) is a chemical compound with the molecular formula C10H22O3Si and a molecular weight of 218.36 g/mol. IUPAC name: ethyl 2-[tert-butyl(dimethyl)silyl]oxyacetate. InChIKey: VMYQJDCENDEETH-UHFFFAOYSA-N.
| Molecular formula | C10H22O3Si |
|---|---|
| Molecular weight | 218.36 g/mol |
| IUPAC name | ethyl 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| InChIKey | VMYQJDCENDEETH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)