cas: 2288709-10-2 — see every product listed under this CAS number, including other names
Ethyl 2-[N-(3-bromo-2-nitrophenyl)methanesulfonamido]acetate, tech grade, 90%, 90% (CAS 2288709-10-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JRRE-100mg |
| cas | 2288709-10-2 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 510.80 Pln | |
| Chemat | 5g | 1638.80 Pln |
| purity | 90% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(3-bromo-N-methylsulfonyl-2-nitroanilino)acetate (CAS 2288709-10-2) is a chemical compound with the molecular formula C11H13BrN2O6S and a molecular weight of 381.20 g/mol. IUPAC name: ethyl 2-(3-bromo-N-methylsulfonyl-2-nitroanilino)acetate. InChIKey: MLRJWFLSZBGNIM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrN2O6S |
|---|---|
| Molecular weight | 381.20 g/mol |
| IUPAC name | ethyl 2-(3-bromo-N-methylsulfonyl-2-nitroanilino)acetate |
| InChIKey | MLRJWFLSZBGNIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C1=C(C(=CC=C1)Br)[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)