Ethyl 2-amino-2-cyanoacetate hemioxalate, 97%
cas: 75470-88-1 — see every product listed under this CAS number, including other names
Ethyl 2-amino-2-cyanoacetate hemioxalate, 97% (CAS 75470-88-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A546046-1g |
| cas | 75470-88-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 993.38 Pln | |
| Ambeed | 10g | 1455.06 Pln | |
| Ambeed | 25g | 2534.19 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1331.60 Pln | |
| Chemat | 25g | 2320.40 Pln | |
| BLDpharm | 1g | 436.54 Pln | |
| BLDpharm | 5g | 969.68 Pln | |
| BLDpharm | 10g | 1430.63 Pln | |
| BLDpharm | 25g | 2491.37 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis(ethyl 2-amino-2-cyanoacetate);oxalic acid (CAS 75470-88-1) is a chemical compound with the molecular formula C12H18N4O8 and a molecular weight of 346.29 g/mol. IUPAC name: bis(ethyl 2-amino-2-cyanoacetate);oxalic acid. InChIKey: YEAUHUDLXGQGFE-UHFFFAOYSA-N.
| Molecular formula | C12H18N4O8 |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | bis(ethyl 2-amino-2-cyanoacetate);oxalic acid |
| InChIKey | YEAUHUDLXGQGFE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)N.CCOC(=O)C(C#N)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)