cas: 79751-43-2 — see every product listed under this CAS number, including other names
Ethyl 2-amino-3-(4-methoxyphenyl)propanoate hydrochloride, 98% (CAS 79751-43-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690643-250MG |
| cas | 79751-43-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 393.63 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride (CAS 79751-43-2) is a chemical compound with the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. IUPAC name: ethyl 2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride. InChIKey: FLMKCSGNZMMXDN-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO3 |
|---|---|
| Molecular weight | 259.73 g/mol |
| IUPAC name | ethyl 2-amino-3-(4-methoxyphenyl)propanoate;hydrochloride |
| InChIKey | FLMKCSGNZMMXDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=CC=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)