cas: 847560-46-7 — see every product listed under this CAS number, including other names
Ethyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate, 98% (CAS 847560-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F337748-250MG |
| cas | 847560-46-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 500mg | 357.18 Pln | |
| Fluorochem | 1g | 596.68 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate (CAS 847560-46-7) is a chemical compound with the molecular formula C9H8ClN3O2S and a molecular weight of 257.70 g/mol. IUPAC name: ethyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate. InChIKey: RVSQDXBPGDMBIQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2S |
|---|---|
| Molecular weight | 257.70 g/mol |
| IUPAC name | ethyl 2-amino-4-chlorothieno[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | RVSQDXBPGDMBIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(S1)N=C(N=C2Cl)N |
Computed by PubChem (NCBI)