cas: 1101856-88-5 — see every product listed under this CAS number, including other names
Ethyl 2-amino-5-Boc-6,7-dihydro-4H-thieno-[3,2-c]pyridine-3-carboxylate, 97%, 97% (CAS 1101856-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HBOT-100mg |
| cas | 1101856-88-5 |
| size | 100mg |
| availability | 190g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 500mg | 1677.20 Pln | |
| Chemat | 1g | 2589.20 Pln | |
| Chemat | 5g | 7648.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-O-tert-butyl 3-O-ethyl 2-amino-6,7-dihydro-4H-thieno[3,2-c]pyridine-3,5-dicarboxylate (CAS 1101856-88-5) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 5-O-tert-butyl 3-O-ethyl 2-amino-6,7-dihydro-4H-thieno[3,2-c]pyridine-3,5-dicarboxylate. InChIKey: INAGTRLHTMQLSC-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 5-O-tert-butyl 3-O-ethyl 2-amino-6,7-dihydro-4H-thieno[3,2-c]pyridine-3,5-dicarboxylate |
| InChIKey | INAGTRLHTMQLSC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CN(CC2)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)