Ethyl 2-bromo-4-(trifluoromethyl)oxazole-5-carboxylate, 95+%
cas: 1227934-69-1 — see every product listed under this CAS number, including other names
Ethyl 2-bromo-4-(trifluoromethyl)oxazole-5-carboxylate, 95+% (CAS 1227934-69-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A157794-100mg |
| cas | 1227934-69-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2367.31 Pln | |
| Ambeed | 5g | 7034.25 Pln | |
| Ambeed | 10g | 11211.69 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 832.40 Pln | |
| Chemat | 1g | 2397.20 Pln | |
| Chemat | 5g | 7072.40 Pln | |
| Chemat | 10g | 11277.20 Pln | |
| BLDpharm | 100mg | 564.27 Pln | |
| BLDpharm | 250mg | 891.93 Pln | |
| BLDpharm | 1g | 2546.91 Pln | |
| BLDpharm | 5g | 7578.47 Pln | |
| BLDpharm | 10g | 12087.99 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate (CAS 1227934-69-1) is a chemical compound with the molecular formula C7H5BrF3NO3 and a molecular weight of 288.02 g/mol. IUPAC name: ethyl 2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate. InChIKey: CNQYPGDMCBJWCI-UHFFFAOYSA-N.
| Molecular formula | C7H5BrF3NO3 |
|---|---|
| Molecular weight | 288.02 g/mol |
| IUPAC name | ethyl 2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate |
| InChIKey | CNQYPGDMCBJWCI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(O1)Br)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
ethyl 2-bromo-4-(trifluoromethyl)-1,3-oxazole-5-carboxylate, C7H5BrF3NO3, 5-Oxazolecarboxylic acid, 2-bromo-4-(trifluoromethyl)-, ethyl ester, 2-bromo-4-(trifluoromethyl)-5-Oxazolecarboxylic acid ethyl ester, ethyl 2-bromo-4-trifluoromethyloxazole-5-carboxylate, Ethyl 2-bromo-4-(trifluoromethyl)oxazole-5-carboxylat