cas: 156498-54-3 — see every product listed under this CAS number, including other names
Ethyl 2-ethoxy-4-methyl-1,3-thiazole-5-carboxylate, 98%, 98% (CAS 156498-54-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ABQR-100mg |
| cas | 156498-54-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 626.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-ethoxy-4-methyl-1,3-thiazole-5-carboxylate (CAS 156498-54-3) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: ethyl 2-ethoxy-4-methyl-1,3-thiazole-5-carboxylate. InChIKey: DLLGPMLSJYMNKL-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | ethyl 2-ethoxy-4-methyl-1,3-thiazole-5-carboxylate |
| InChIKey | DLLGPMLSJYMNKL-UHFFFAOYSA-N |
| SMILES | CCOC1=NC(=C(S1)C(=O)OCC)C |
Computed by PubChem (NCBI)