cas: 1198615-86-9 — see every product listed under this CAS number, including other names
Ethyl 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 95% (CAS 1198615-86-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F758426-250MG |
| cas | 1198615-86-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 643.54 Pln | |
| Fluorochem | 5g | 2314.83 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1198615-86-9) is a chemical compound with the molecular formula C15H20BFO4 and a molecular weight of 294.13 g/mol. IUPAC name: ethyl 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: OMMPUXRIZFPVNV-UHFFFAOYSA-N.
| Molecular formula | C15H20BFO4 |
|---|---|
| Molecular weight | 294.13 g/mol |
| IUPAC name | ethyl 2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | OMMPUXRIZFPVNV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(=O)OCC)F |
Computed by PubChem (NCBI)