cas: 36294-24-3 — see every product listed under this CAS number, including other names
Ethyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoate, 98%, 98% (CAS 36294-24-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148BK-100mg |
| cas | 36294-24-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 501.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (CAS 36294-24-3) is a chemical compound with the molecular formula C19H30O3 and a molecular weight of 306.4 g/mol. IUPAC name: ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate. InChIKey: ZCWSUZJGZZFSHM-UHFFFAOYSA-N.
| Molecular formula | C19H30O3 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | ethyl 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| InChIKey | ZCWSUZJGZZFSHM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)