cas: 1093115-27-5 — see every product listed under this CAS number, including other names
Ethyl 3-(3-fluoropyridin-2-yl)-3-oxopropanoate 95% (CAS 1093115-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A866243-100mg |
| cas | 1093115-27-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 581.75 Pln | |
| Ambeed | 1g | 1354.94 Pln | |
| Ambeed | 5g | 4631.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A866243 |
Ethyl 3-(3-fluoro-2-pyridinyl)-3-oxopropanoate (CAS 1093115-27-5) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: ethyl 3-(3-fluoro-2-pyridinyl)-3-oxopropanoate. InChIKey: IPVDCFDOQGHIEC-UHFFFAOYSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | ethyl 3-(3-fluoro-2-pyridinyl)-3-oxopropanoate |
| InChIKey | IPVDCFDOQGHIEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=C(C=CC=N1)F |
Computed by PubChem (NCBI)