cas: 56119-28-9 — see every product listed under this CAS number, including other names
Ethyl 4,6-O-benzylidene-b-D-thiogalactopyranoside (CAS 56119-28-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM83750C-10g |
| cas | 56119-28-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 5587.99 Pln | |
| Chemat | 1g | 1335.37 Pln | |
| Chemat | 25g | 11422.42 Pln | |
| Chemat | 2g | 1929.08 Pln | |
| Chemat | 5g | 3510.46 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
(4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (CAS 56119-28-9) is a chemical compound with the molecular formula C15H20O5S and a molecular weight of 312.4 g/mol. IUPAC name: (4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol. InChIKey: QOMMDHDGIYADCQ-VWZINJBZSA-N.
| Molecular formula | C15H20O5S |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (4aR,6S,7R,8R,8aR)-6-ethylsulfanyl-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| InChIKey | QOMMDHDGIYADCQ-VWZINJBZSA-N |
| SMILES | CCS[C@H]1[C@@H]([C@H]([C@@H]2[C@H](O1)COC(O2)C3=CC=CC=C3)O)O |
Computed by PubChem (NCBI)