cas: 56441-55-5 — see every product listed under this CAS number, including other names
Ethyl 4-(benzyloxy)benzoate, 98%, 98% (CAS 56441-55-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q05-1g |
| cas | 56441-55-5 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 25g | 318.80 Pln | |
| Chemat | 100g | 837.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-phenylmethoxybenzoate (CAS 56441-55-5) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: ethyl 4-phenylmethoxybenzoate. InChIKey: UMOKJIWMQFEFJE-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | ethyl 4-phenylmethoxybenzoate |
| InChIKey | UMOKJIWMQFEFJE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)