CAS 54073-94-8 appears in our catalog under these names: Ethyl 4–hydroxy–3,5–diiodobenzoate, Ethyl 4-hydroxy-3,5-diiodobenzoate, 95%, 95%, Ethyl 4-hydroxy-3,5-diiodobenzoate, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g.
Ethyl 4-hydroxy-3,5-diiodobenzoate (CAS 54073-94-8) is a chemical compound with the molecular formula C9H8I2O3 and a molecular weight of 417.97 g/mol. IUPAC name: ethyl 4-hydroxy-3,5-diiodobenzoate. InChIKey: AVFDHVCJEMRWFS-UHFFFAOYSA-N.
| Molecular formula | C9H8I2O3 |
|---|---|
| Molecular weight | 417.97 g/mol |
| IUPAC name | ethyl 4-hydroxy-3,5-diiodobenzoate |
| InChIKey | AVFDHVCJEMRWFS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)I)O)I |
Computed by PubChem (NCBI)