cas: 1187929-23-2 — see every product listed under this CAS number, including other names
Ethyl 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate hydrochloride, 97%, 97% (CAS 1187929-23-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1103JA-100mg |
| cas | 1187929-23-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 923.60 Pln | |
| Chemat | 250mg | 1288.40 Pln | |
| Chemat | 1g | 3626.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate;hydrochloride (CAS 1187929-23-2) is a chemical compound with the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. IUPAC name: ethyl 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate;hydrochloride. InChIKey: LYXIWXDEKFMUBG-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN3O2 |
|---|---|
| Molecular weight | 231.68 g/mol |
| IUPAC name | ethyl 5,6,7,8-tetrahydroimidazo[1,5-a]pyrazine-1-carboxylate;hydrochloride |
| InChIKey | LYXIWXDEKFMUBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2CNCCN2C=N1.Cl |
Computed by PubChem (NCBI)