cas: 960116-27-2 — see every product listed under this CAS number, including other names
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate 95+% (CAS 960116-27-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A183405-100mg |
| cas | 960116-27-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 359.25 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A183405 |
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate (CAS 960116-27-2) is a chemical compound with the molecular formula C13H19BO4S and a molecular weight of 282.2 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate. InChIKey: UKOWLIGHMFVYFW-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4S |
|---|---|
| Molecular weight | 282.2 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene-3-carboxylate |
| InChIKey | UKOWLIGHMFVYFW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)C(=O)OCC |
Computed by PubChem (NCBI)