cas: 175203-82-4 — see every product listed under this CAS number, including other names
Ethyl 5-(trifluoromethoxy)-1H-indole-2-carboxylate 98% (CAS 175203-82-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208951-250mg |
| cas | 175203-82-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2873.50 Pln | |
| Ambeed | 10g | 4864.88 Pln | |
| Ambeed | 25g | 9943.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208951 |
Ethyl 5-(trifluoromethoxy)-1H-indole-2-carboxylate (CAS 175203-82-4) is a chemical compound with the molecular formula C12H10F3NO3 and a molecular weight of 273.21 g/mol. IUPAC name: ethyl 5-(trifluoromethoxy)-1H-indole-2-carboxylate. InChIKey: LLGKTDNPBIFJKJ-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO3 |
|---|---|
| Molecular weight | 273.21 g/mol |
| IUPAC name | ethyl 5-(trifluoromethoxy)-1H-indole-2-carboxylate |
| InChIKey | LLGKTDNPBIFJKJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)OC(F)(F)F |
Computed by PubChem (NCBI)