cas: 16459-35-1 — see every product listed under this CAS number, including other names
Ethyl 5-amino-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate 97% (CAS 16459-35-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A133811-1g |
| cas | 16459-35-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 225.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A133811 |
Ethyl 5-amino-1-(4-nitrophenyl)pyrazole-4-carboxylate (CAS 16459-35-1) is a chemical compound with the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. IUPAC name: ethyl 5-amino-1-(4-nitrophenyl)pyrazole-4-carboxylate. InChIKey: IQYXMFOQGPEJHU-UHFFFAOYSA-N.
| Molecular formula | C12H12N4O4 |
|---|---|
| Molecular weight | 276.25 g/mol |
| IUPAC name | ethyl 5-amino-1-(4-nitrophenyl)pyrazole-4-carboxylate |
| InChIKey | IQYXMFOQGPEJHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)