cas: 1427376-40-6 — see every product listed under this CAS number, including other names
Ethyl 6-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate 95% (CAS 1427376-40-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1068557-50mg |
| cas | 1427376-40-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 859.88 Pln | |
| Ambeed | 100mg | 1087.94 Pln | |
| Ambeed | 250mg | 2039.12 Pln | |
| Ambeed | 1g | 4180.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1068557 |
Ethyl 6-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate (CAS 1427376-40-6) is a chemical compound with the molecular formula C9H8BrN3O2 and a molecular weight of 270.08 g/mol. IUPAC name: ethyl 6-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate. InChIKey: YUZDMLVJWWDRAQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O2 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | ethyl 6-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylate |
| InChIKey | YUZDMLVJWWDRAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2C=C(C=CC2=N1)Br |
Computed by PubChem (NCBI)