cas: 1159976-38-1 — see every product listed under this CAS number, including other names
Ethyl 6-bromo-4-chloroquinazoline-2-carboxylate, 98%, 98% (CAS 1159976-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111HES-100mg |
| cas | 1159976-38-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 702.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-bromo-4-chloroquinazoline-2-carboxylate (CAS 1159976-38-1) is a chemical compound with the molecular formula C11H8BrClN2O2 and a molecular weight of 315.55 g/mol. IUPAC name: ethyl 6-bromo-4-chloroquinazoline-2-carboxylate. InChIKey: LVPLDTSUQVYGIZ-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClN2O2 |
|---|---|
| Molecular weight | 315.55 g/mol |
| IUPAC name | ethyl 6-bromo-4-chloroquinazoline-2-carboxylate |
| InChIKey | LVPLDTSUQVYGIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=C(C=C2)Br)C(=N1)Cl |
Computed by PubChem (NCBI)