cas: 1189105-79-0 — see every product listed under this CAS number, including other names
Ethyl 7-bromo-4-chloroquinazoline-2-carboxylate, ≥97%, ≥97% (CAS 1189105-79-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104JG-250mg |
| cas | 1189105-79-0 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 885.20 Pln | |
| Chemat | 500mg | 1494.80 Pln | |
| Chemat | 1g | 2253.20 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 7-bromo-4-chloroquinazoline-2-carboxylate (CAS 1189105-79-0) is a chemical compound with the molecular formula C11H8BrClN2O2 and a molecular weight of 315.55 g/mol. IUPAC name: ethyl 7-bromo-4-chloroquinazoline-2-carboxylate. InChIKey: WNPLYNAOTKPPLG-UHFFFAOYSA-N.
| Molecular formula | C11H8BrClN2O2 |
|---|---|
| Molecular weight | 315.55 g/mol |
| IUPAC name | ethyl 7-bromo-4-chloroquinazoline-2-carboxylate |
| InChIKey | WNPLYNAOTKPPLG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(C=CC(=C2)Br)C(=N1)Cl |
Computed by PubChem (NCBI)