cas: 2250023-38-0 — see every product listed under this CAS number, including other names
Ethyl 7-bromo-6-chloro-1H-benzo[d]imidazole-2-carboxylate, 97% (CAS 2250023-38-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546336-100MG |
| cas | 2250023-38-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 997.58 Pln | |
| Fluorochem | 1g | 2372.10 Pln | |
| Fluorochem | 5g | 8109.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 4-bromo-5-chloro-1H-benzimidazole-2-carboxylate (CAS 2250023-38-0) is a chemical compound with the molecular formula C10H8BrClN2O2 and a molecular weight of 303.54 g/mol. IUPAC name: ethyl 4-bromo-5-chloro-1H-benzimidazole-2-carboxylate. InChIKey: PPGXAMHHSYQKIP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2O2 |
|---|---|
| Molecular weight | 303.54 g/mol |
| IUPAC name | ethyl 4-bromo-5-chloro-1H-benzimidazole-2-carboxylate |
| InChIKey | PPGXAMHHSYQKIP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=C(N1)C=CC(=C2Br)Cl |
Computed by PubChem (NCBI)