cas: 1135070-98-2 — see every product listed under this CAS number, including other names
Ethyl–β–D–Glucuronide–d5 (CAS 1135070-98-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 5mg, 500μg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC90194-1 |
| cas | 1135070-98-2 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 1682.92 Pln | |
| GLPBio | 10mg | 7098.25 Pln | |
| GLPBio | 5mg | 5090.32 Pln | |
| GLPBio | 500μg | 1083.81 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(1,1,2,2,2-pentadeuterioethoxy)oxane-2-carboxylic acid (CAS 1135070-98-2) is a chemical compound with the molecular formula C8H14O7 and a molecular weight of 227.22 g/mol. IUPAC name: (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(1,1,2,2,2-pentadeuterioethoxy)oxane-2-carboxylic acid. InChIKey: IWJBVMJWSPZNJH-XTJTXKPGSA-N.
| Molecular formula | C8H14O7 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(1,1,2,2,2-pentadeuterioethoxy)oxane-2-carboxylic acid |
| InChIKey | IWJBVMJWSPZNJH-XTJTXKPGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)C(=O)O)O)O)O |
Computed by PubChem (NCBI)