CAS 60842-46-8 appears in our catalog under these names: FITC-Dextran (MW 10000), FITC–Dextran (MW 4000) , FITC–Dextran (MW 40000), FITC–Dextran (MW 70000), FITC–dextran (MW 500,000). Offered by: TargetMol, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5mg, 10mg, 25mg, 100mg, 1g, 50mg, 500mg, 5g.
(6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid (CAS 60842-46-8) is a chemical compound with the molecular formula C21H13NO6S and a molecular weight of 407.4 g/mol. IUPAC name: (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid. InChIKey: PUQQBNGWUKSTLB-UHFFFAOYSA-N.
| Molecular formula | C21H13NO6S |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | (6'-hydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl)oxycarbamothioic S-acid |
| InChIKey | PUQQBNGWUKSTLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)ONC(=O)S |
Computed by PubChem (NCBI)