cas: 135415-73-5 — see every product listed under this CAS number, including other names
FL118 98% (CAS 135415-73-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1369554-1mg |
| cas | 135415-73-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 203.50 Pln | |
| Ambeed | 5mg | 409.31 Pln | |
| Ambeed | 10mg | 642.94 Pln | |
| Ambeed | 25mg | 826.50 Pln | |
| Ambeed | 50mg | 1410.56 Pln | |
| Ambeed | 100mg | 2333.94 Pln | |
| Ambeed | 250mg | 4597.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1369554 |
(5S)-5-ethyl-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2,4(9),14,16,21,23-heptaene-6,10-dione (CAS 135415-73-5) is a chemical compound with the molecular formula C21H16N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: (5S)-5-ethyl-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2,4(9),14,16,21,23-heptaene-6,10-dione. InChIKey: RPFYDENHBPRCTN-NRFANRHFSA-N.
| Molecular formula | C21H16N2O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | (5S)-5-ethyl-5-hydroxy-7,18,20-trioxa-11,24-diazahexacyclo[11.11.0.02,11.04,9.015,23.017,21]tetracosa-1(13),2,4(9),14,16,21,23-heptaene-6,10-dione |
| InChIKey | RPFYDENHBPRCTN-NRFANRHFSA-N |
| SMILES | CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=C6C(=CC5=C4)OCO6)O |
Computed by PubChem (NCBI)