cas: 677305-02-1 — see every product listed under this CAS number, including other names
Facinicline hydrochloride (CAS 677305-02-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso). Offered by: TargetMol, GLPBio, Biosynth.
| brand | TargetMol |
|---|---|
| catalog number | T28531-1mg |
| cas | 677305-02-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 704.78 Pln | |
| TargetMol | 5mg | 1442.10 Pln | |
| TargetMol | 10mg | 2205.69 Pln | |
| TargetMol | 25mg | 3507.04 Pln | |
| TargetMol | 50mg | 4788.83 Pln | |
| GLPBio | 10mg | 2586.25 Pln | |
| GLPBio | 100mg | 9958.04 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1846.73 Pln | |
| GLPBio | 5mg | 1715.68 Pln | |
| GLPBio | 50mg | 6489.79 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 50mg | price on request |
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1H-indazole-3-carboxamide;hydrochloride (CAS 677305-02-1) is a chemical compound with the molecular formula C15H19ClN4O and a molecular weight of 306.79 g/mol. IUPAC name: N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1H-indazole-3-carboxamide;hydrochloride. InChIKey: CMRLNEYJEPELSM-BTQNPOSSSA-N.
| Molecular formula | C15H19ClN4O |
|---|---|
| Molecular weight | 306.79 g/mol |
| IUPAC name | N-[(3S)-1-azabicyclo[2.2.2]octan-3-yl]-1H-indazole-3-carboxamide;hydrochloride |
| InChIKey | CMRLNEYJEPELSM-BTQNPOSSSA-N |
| SMILES | C1CN2CCC1[C@@H](C2)NC(=O)C3=NNC4=CC=CC=C43.Cl |
Computed by PubChem (NCBI)