Fantofarone
cas: 114432-13-2 — see every product listed under this CAS number, including other names
Fantofarone (CAS 114432-13-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso). Offered by: TargetMol, GLPBio.
| brand | TargetMol |
|---|---|
| catalog number | T4669-5mg |
| cas | 114432-13-2 |
| size | 5mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 5mg | 465.53 Pln | |
| TargetMol | 10mg | 658.38 Pln | |
| TargetMol | 25mg | 1129.62 Pln | |
| TargetMol | 50mg | 1740.60 Pln | |
| TargetMol | 100mg | 2212.40 Pln | |
| TargetMol | 200mg | 3095.62 Pln | |
| GLPBio | 1mg | 583.00 Pln | |
| GLPBio | 10mg | 1046.37 Pln | |
| GLPBio | 25mg | 1678.24 Pln | |
| GLPBio | 5mg | 793.62 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1111.89 Pln | |
| GLPBio | 50mg | 2520.73 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine (CAS 114432-13-2) is a chemical compound with the molecular formula C31H38N2O5S and a molecular weight of 550.7 g/mol. IUPAC name: N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine. InChIKey: ITAMRBIZWGDOHW-UHFFFAOYSA-N.
| Molecular formula | C31H38N2O5S |
|---|---|
| Molecular weight | 550.7 g/mol |
| IUPAC name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propan-1-amine |
| InChIKey | ITAMRBIZWGDOHW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CN2C=CC=CC2=C1S(=O)(=O)C3=CC=C(C=C3)OCCCN(C)CCC4=CC(=C(C=C4)OC)OC |
Computed by PubChem (NCBI)