Filgotinib 99%
cas: 1206161-97-8 — see every product listed under this CAS number, including other names
Filgotinib 99% (CAS 1206161-97-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A302163-1mg |
| cas | 1206161-97-8 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 153.44 Pln | |
| Ambeed | 5mg | 186.81 Pln | |
| Ambeed | 10mg | 209.06 Pln | |
| Ambeed | 25mg | 248.00 Pln | |
| Ambeed | 50mg | 309.19 Pln | |
| Ambeed | 100mg | 442.69 Pln | |
| Ambeed | 250mg | 809.81 Pln | |
| Ambeed | 1g | 1922.31 Pln | |
| Ambeed | 5g | 6694.94 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A302163 |
N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide (CAS 1206161-97-8) is a chemical compound with the molecular formula C21H23N5O3S and a molecular weight of 425.5 g/mol. IUPAC name: N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide. InChIKey: RIJLVEAXPNLDTC-UHFFFAOYSA-N.
| Molecular formula | C21H23N5O3S |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | N-[5-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]cyclopropanecarboxamide |
| InChIKey | RIJLVEAXPNLDTC-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=NN3C(=N2)C=CC=C3C4=CC=C(C=C4)CN5CCS(=O)(=O)CC5 |
Computed by PubChem (NCBI)