CAS 7262-39-7 appears in our catalog under these names: FLUORESCEIN O,O'-DIACRYLATE, 98%, Fluorescein O,O′-diacrylate, 98%, 98%, Fluorescein O,O′-diacrylate, 99.35%. Offered by: Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 500MG, 100mg, 250mg, 1g, 25 mg, 100 mg, 250 mg, 10 mg.
(3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate (CAS 7262-39-7) is a chemical compound with the molecular formula C26H16O7 and a molecular weight of 440.4 g/mol. IUPAC name: (3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate. InChIKey: GTQZGVDHWVBMOJ-UHFFFAOYSA-N.
| Molecular formula | C26H16O7 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | (3-oxo-6'-prop-2-enoyloxyspiro[2-benzofuran-1,9'-xanthene]-3'-yl) prop-2-enoate |
| InChIKey | GTQZGVDHWVBMOJ-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C=C)C5=CC=CC=C5C(=O)O3 |
Computed by PubChem (NCBI)