CAS 75350-46-8 appears in our catalog under these names: Fluorescein-5-maleimide, 95%, Fluorescein 5-Maleimide (90%), Fluorescein-5-maleimide/ 97.42% (existing batch purity), Fluorescein–5–maleimide (N–(5–Fluoresceinyl)maleimide), Fluorescein-5-maleimide (contains 2% N,N-Dimethylformamide at maximum), >97.0%(HPLC). Offered by: Combi-blocks, TRC, TargetMol, GLPBio, TCI. Available pack sizes: 25mg, 5mg, 10mg, 50mg, 100mg, 10mM (in 1ml dmso), 500mg, 250mg.
1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pyrrole-2,5-dione (CAS 75350-46-8) is a chemical compound with the molecular formula C24H13NO7 and a molecular weight of 427.4 g/mol. IUPAC name: 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pyrrole-2,5-dione. InChIKey: AYDAHOIUHVUJHQ-UHFFFAOYSA-N.
| Molecular formula | C24H13NO7 |
|---|---|
| Molecular weight | 427.4 g/mol |
| IUPAC name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)pyrrole-2,5-dione |
| InChIKey | AYDAHOIUHVUJHQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N3C(=O)C=CC3=O)C(=O)OC24C5=C(C=C(C=C5)O)OC6=C4C=CC(=C6)O |
Computed by PubChem (NCBI)