cas: 1807518-76-8 — see every product listed under this CAS number, including other names
Fluorescein-PEG4-acid 95% (CAS 1807518-76-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756658-50mg |
| cas | 1807518-76-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 654.06 Pln | |
| Ambeed | 100mg | 976.69 Pln | |
| Ambeed | 250mg | 1788.81 Pln | |
| Ambeed | 1g | 4709.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756658 |
3-[2-[2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1807518-76-8) is a chemical compound with the molecular formula C32H34N2O11S and a molecular weight of 654.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: DSZDFOCKVIPCKO-UHFFFAOYSA-N.
| Molecular formula | C32H34N2O11S |
|---|---|
| Molecular weight | 654.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | DSZDFOCKVIPCKO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=S)NCCOCCOCCOCCOCCC(=O)O)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Computed by PubChem (NCBI)