cas: 214750-75-1 — see every product listed under this CAS number, including other names
Fmoc–D–Lys(Aloc)–OH (CAS 214750-75-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA21632-10000 |
| cas | 214750-75-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1008.92 Pln | |
| GLPBio | 100g | 1968.43 Pln | |
| GLPBio | 25g | 1158.70 Pln | |
| GLPBio | 5g | 957.44 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid (CAS 214750-75-1) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid. InChIKey: OJBNDXHENJDCBA-JOCHJYFZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoxycarbonylamino)hexanoic acid |
| InChIKey | OJBNDXHENJDCBA-JOCHJYFZSA-N |
| SMILES | C=CCOC(=O)NCCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)