cas: 157887-82-6 — see every product listed under this CAS number, including other names
Fmoc-β-Ala-ol 97% (CAS 157887-82-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A167565-250mg |
| cas | 157887-82-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 782.00 Pln | |
| Ambeed | 500g | 2812.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A167565 |
9H-fluoren-9-ylmethyl N-(3-hydroxypropyl)carbamate (CAS 157887-82-6) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(3-hydroxypropyl)carbamate. InChIKey: GNXZNUJDAMSJFZ-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(3-hydroxypropyl)carbamate |
| InChIKey | GNXZNUJDAMSJFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCO |
Computed by PubChem (NCBI)