cas: 1274891-91-6 — see every product listed under this CAS number, including other names
Fmoc-1,3-cis-damch hcl, ≥99%, ≥99% (CAS 1274891-91-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRPD-25mg |
| cas | 1274891-91-6 |
| size | 25mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 501.20 Pln | |
| Chemat | 100mg | 1082.00 Pln | |
| Chemat | 250mg | 2032.40 Pln | |
| Chemat | 1g | 5171.60 Pln |
| purity | ≥99% |
|---|---|
| delivery time | 3 weeks |
9H-fluoren-9-ylmethyl N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]carbamate;hydrochloride (CAS 1274891-91-6) is a chemical compound with the molecular formula C23H29ClN2O2 and a molecular weight of 400.9 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]carbamate;hydrochloride. InChIKey: JSQJBDLZQXUBNV-PPPUBMIESA-N.
| Molecular formula | C23H29ClN2O2 |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[[(1S,3R)-3-(aminomethyl)cyclohexyl]methyl]carbamate;hydrochloride |
| InChIKey | JSQJBDLZQXUBNV-PPPUBMIESA-N |
| SMILES | C1C[C@H](C[C@H](C1)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CN.Cl |
Computed by PubChem (NCBI)