cas: 266999-24-0 — see every product listed under this CAS number, including other names
Fmoc-3-(Boc-aminomethyl)-L-phenylalanine, 99%, 99% (CAS 266999-24-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4LJ-100mg |
| cas | 266999-24-0 |
| size | 100mg |
| availability | 250g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 10g | 4197.20 Pln | |
| Chemat | 50g | 5589.20 Pln | |
| Chemat | 100g | 8546.00 Pln | |
| Chemat | 250g | 16298.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid (CAS 266999-24-0) is a chemical compound with the molecular formula C30H32N2O6 and a molecular weight of 516.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid. InChIKey: CLXDODPHMWMJCQ-SANMLTNESA-N.
| Molecular formula | C30H32N2O6 |
|---|---|
| Molecular weight | 516.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]propanoic acid |
| InChIKey | CLXDODPHMWMJCQ-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=CC(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)