cas: 331763-60-1 — see every product listed under this CAS number, including other names
Fmoc-4-chloro-D-β-homophenylalanine 95% (CAS 331763-60-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A871242-100mg |
| cas | 331763-60-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 537.25 Pln | |
| Ambeed | 5g | 2389.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A871242 |
(3R)-4-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 331763-60-1) is a chemical compound with the molecular formula C25H22ClNO4 and a molecular weight of 435.9 g/mol. IUPAC name: (3R)-4-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: FMGGSUXYRDKFJX-GOSISDBHSA-N.
| Molecular formula | C25H22ClNO4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | (3R)-4-(4-chlorophenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | FMGGSUXYRDKFJX-GOSISDBHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=C(C=C4)Cl)CC(=O)O |
Computed by PubChem (NCBI)