cas: 369403-24-7 — see every product listed under this CAS number, including other names
Fmoc-8-amino-1,4-dioxa-spiro[4,5]decane-8-carboxylic acid 95% (CAS 369403-24-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A445349-25mg |
| cas | 369403-24-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 248.00 Pln | |
| Ambeed | 100mg | 526.12 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2778.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A445349 |
8-(9H-fluoren-9-ylmethoxycarbonylamino)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid (CAS 369403-24-7) is a chemical compound with the molecular formula C24H25NO6 and a molecular weight of 423.5 g/mol. IUPAC name: 8-(9H-fluoren-9-ylmethoxycarbonylamino)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid. InChIKey: JACJNSRYTDVVMR-UHFFFAOYSA-N.
| Molecular formula | C24H25NO6 |
|---|---|
| Molecular weight | 423.5 g/mol |
| IUPAC name | 8-(9H-fluoren-9-ylmethoxycarbonylamino)-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| InChIKey | JACJNSRYTDVVMR-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)OCCO2 |
Computed by PubChem (NCBI)