Fmoc-Ala-Ser[Psi(Me,Me)Pro]-OH, 98%, 98%
cas: 252554-78-2 — see every product listed under this CAS number, including other names
Fmoc-Ala-Ser[Psi(Me,Me)Pro]-OH, 98%, 98% (CAS 252554-78-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C2OL-100mg |
| cas | 252554-78-2 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 515.60 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1922.00 Pln | |
| Chemat | 50g | 3645.20 Pln | |
| Chemat | 100g | 5219.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid (CAS 252554-78-2) is a chemical compound with the molecular formula C24H26N2O6 and a molecular weight of 438.5 g/mol. IUPAC name: (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid. InChIKey: QMRGOZHWQFEGGB-XOBRGWDASA-N.
| Molecular formula | C24H26N2O6 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | (4S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |
| InChIKey | QMRGOZHWQFEGGB-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)N1[C@@H](COC1(C)C)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Ala-Ser(yMe,Mepro)-OH, Fmoc-Ala-Ser(Psi(Me,Me)pro)-OH, Fmoc-Ala-Ser[Psi(Me,Me)Pro]-OH, Fmoc-Ala-Ser(Psime,Mepro)-OH, (S)-3-[(S)-2-(Fmoc-amino)propanoyl]-2,2-dimethyloxazolidine-4-carboxylic Acid, orb1909080, Fmoc-Ala-Ser(|xMe,Mepro)-OH, Fmoc-L-Ala-L-Ser(Psi(Me,Me)pro)-OH, Fmoc-Ala-Ser(psiMe,MePro)-OH, AldrichCPR