cas: 154445-77-9 — see every product listed under this CAS number, including other names
Fmoc-Arg(Pbf)-OH, 98%+, 98%+ (CAS 154445-77-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250g, 500g, 1kg, 50g, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140MD-1g |
| cas | 154445-77-9 |
| size | 1g |
| availability | 25000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 250g | 818.00 Pln | |
| Chemat | 500g | 1406.40 Pln | |
| Chemat | 1kg | 2661.20 Pln | |
| Chemat | 50g | 222.80 Pln | |
| Chemat | 5kg | 10137.60 Pln |
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 154445-77-9) is a chemical compound with the molecular formula C34H40N4O7S and a molecular weight of 648.8 g/mol. IUPAC name: (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: HNICLNKVURBTKV-NDEPHWFRSA-N.
| Molecular formula | C34H40N4O7S |
|---|---|
| Molecular weight | 648.8 g/mol |
| IUPAC name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HNICLNKVURBTKV-NDEPHWFRSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)N)C |
Computed by PubChem (NCBI)